Bdtyk

1 Is there any reasoning/explanation as to why Melisandre would birth a shadow if she was a follower of the Lord of the Light religion? It seems somewhat contradictive that a Light worshiper would birth a form of darkness... Follow up question: why did the shadow disappear immediately after killing Renly? Why not stay around longer to perform other biddings for Stanis? game-of-thrones share | improve this question asked 1 hour ago Charles Charles 290 9 24 add

Никотинамидадениндинуклеотид Общие Хим. формула C₂₁H₂₇N₇O₁₄P₂ Физические свойства Состояние белый порошок Молярная масса 663,43 г/моль Термические свойства Т. плав. 160 ℃ Химические свойства Растворимость в воде 1 г/100 мл Классификация Номер CAS 53-84-9 PubChem 5892 ChemSpider 5681 Номер EINECS 200-184-4 RTECS UU3450000 ChEBI 44215 DrugBank DB14128 SMILES C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C4N=CN=C5N)O)O)O)O)C(=O)N InChI 1S/C21H27N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1-4,7-8,10-11,13-16,20-21,29-32H,5-6H2,(H5-,22,23,24,25,33,34,35,36,37)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 Приводятся данные для стандартных условий (25 ℃, 100 кПа), если не указано иное. Эта статья — о химическом соединении. О производителе звуковой аппаратуры см. NAD